C21H22N2 — CID 92527910
4-[(Z)-2-(6,8-dimethylquinolin-4-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 92527910) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[(Z)-2-(6,8-dimethylquinolin-4-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-2-(6,8-dimethylquinolin-4-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 92527910 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[(Z)-2-(6,8-dimethylquinolin-4-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | Cc1cc(C)c2nccc(/C=C\c3ccc(N(C)C)cc3)c2c1 |
| InChI | InChI=1S/C21H22N2/c1-15-13-16(2)21-20(14-15)18(11-12-22-21)8-5-17-6-9-19(10-7-17)23(3)4/h5-14H,1-4H3/b8-5- |
| InChIKey | IBHYYZVZCOADBR-YVMONPNESA-N |
| XLogP | 5.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|