C19H25ClO — CID 92533358
(4aR,4bS,8aS,9aS)-9-(4-chlorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-ol (PubChem CID 92533358) has the molecular formula C19H25ClO and a molecular weight of 304.86 g/mol. Its IUPAC name is (4aR,4bS,8aS,9aS)-9-(4-chlorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-ol.
| Compound Name | (4aR,4bS,8aS,9aS)-9-(4-chlorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-ol |
|---|---|
| PubChem CID | 92533358 |
| Molecular Formula | C19H25ClO |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (4aR,4bS,8aS,9aS)-9-(4-chlorophenyl)-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluoren-9-ol |
| SMILES | OC1(c2ccc(Cl)cc2)[C@H]2CCCC[C@@H]2[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H25ClO/c20-14-11-9-13(10-12-14)19(21)17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h9-12,15-18,21H,1-8H2/t15-,16+,17-,18-,19?/m0/s1 |
| InChIKey | JURZIEQMPUPRTR-YMNIQUSHSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |