C15H8ClN3OS2 — CID 92534733
(E)-3-(3-chloro-1-benzothiophen-2-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 92534733) has the molecular formula C15H8ClN3OS2 and a molecular weight of 345.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-1-benzothiophen-2-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 92534733 |
| Molecular Formula | C15H8ClN3OS2 |
| Molecular Weight | 345.84 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-2-cyano-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1sc2ccccc2c1Cl)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C15H8ClN3OS2/c16-13-10-3-1-2-4-11(10)22-12(13)7-9(8-17)14(20)19-15-18-5-6-21-15/h1-7H,(H,18,19,20)/b9-7+ |
| InChIKey | PBCPPJDIYHJFID-VQHVLOKHSA-N |
| XLogP | 4.56 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.84 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|