C18H31N3O2+2 — CID 9268033
(4-acetamidophenyl)methyl-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]azanium (PubChem CID 9268033) has the molecular formula C18H31N3O2+2 and a molecular weight of 321.47 g/mol. Its IUPAC name is (4-acetamidophenyl)methyl-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]azanium.
| Compound Name | (4-acetamidophenyl)methyl-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 9268033 |
| Molecular Formula | C18H31N3O2+2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | (4-acetamidophenyl)methyl-[[(2R)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]azanium |
| SMILES | CC(=O)Nc1ccc(C[NH2+]C[C@@H]2C[NH+](CC(C)C)CCO2)cc1 |
| InChI | InChI=1S/C18H29N3O2/c1-14(2)12-21-8-9-23-18(13-21)11-19-10-16-4-6-17(7-5-16)20-15(3)22/h4-7,14,18-19H,8-13H2,1-3H3,(H,20,22)/p+2/t18-/m1/s1 |
| InChIKey | QXBTWVWXUCAWPR-GOSISDBHSA-P |
| XLogP | -0.35 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |