C24H23N5O2 — CID 92702096
1-[(2R)-1-(4-oxo-1,2,3-benzotriazin-3-yl)butan-2-yl]-3-(2-phenylphenyl)urea (PubChem CID 92702096) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-[(2R)-1-(4-oxo-1,2,3-benzotriazin-3-yl)butan-2-yl]-3-(2-phenylphenyl)urea.
| Compound Name | 1-[(2R)-1-(4-oxo-1,2,3-benzotriazin-3-yl)butan-2-yl]-3-(2-phenylphenyl)urea |
|---|---|
| PubChem CID | 92702096 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[(2R)-1-(4-oxo-1,2,3-benzotriazin-3-yl)butan-2-yl]-3-(2-phenylphenyl)urea |
| SMILES | CC[C@H](Cn1nnc2ccccc2c1=O)NC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H23N5O2/c1-2-18(16-29-23(30)20-13-7-9-15-22(20)27-28-29)25-24(31)26-21-14-8-6-12-19(21)17-10-4-3-5-11-17/h3-15,18H,2,16H2,1H3,(H2,25,26,31)/t18-/m1/s1 |
| InChIKey | UJEVEPITERFHEK-GOSISDBHSA-N |
| XLogP | 4.06 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |