C19H20ClN3O3 — CID 9271309
(4-oxo-1,2,3-benzotriazin-3-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 9271309) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is (4-oxo-1,2,3-benzotriazin-3-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 9271309 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (4-oxo-1,2,3-benzotriazin-3-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(OCn1nnc2ccccc2c1=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C19H20ClN3O3/c20-19-8-12-5-13(9-19)7-18(6-12,10-19)17(25)26-11-23-16(24)14-3-1-2-4-15(14)21-22-23/h1-4,12-13H,5-11H2/t12-,13+,18?,19? |
| InChIKey | TYINTZFADFSLRQ-NFAYLAGKSA-N |
| XLogP | 2.87 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|