C20H24N4O2S — CID 92756973
4-[(E)-[1-[(2R)-butan-2-yl]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 92756973) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 4-[(E)-[1-[(2R)-butan-2-yl]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(E)-[1-[(2R)-butan-2-yl]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 92756973 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-[(E)-[1-[(2R)-butan-2-yl]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CC[C@@H](C)N1C(=O)/C(=C\c2c(C)n(C)n(-c3ccccc3)c2=O)N(C)C1=S |
| InChI | InChI=1S/C20H24N4O2S/c1-6-13(2)23-19(26)17(21(4)20(23)27)12-16-14(3)22(5)24(18(16)25)15-10-8-7-9-11-15/h7-13H,6H2,1-5H3/b17-12+/t13-/m1/s1 |
| InChIKey | WTUDPQLTXHNJKI-LVLBFHFTSA-N |
| XLogP | 2.68 |
| TPSA | 50.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|