C29H26N4O2S — CID 71959902
4-[(1-benzhydryl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 71959902) has the molecular formula C29H26N4O2S and a molecular weight of 494.62 g/mol. Its IUPAC name is 4-[(1-benzhydryl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(1-benzhydryl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 71959902 |
| Molecular Formula | C29H26N4O2S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 4-[(1-benzhydryl-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(C=C2C(=O)N(C(c3ccccc3)c3ccccc3)C(=S)N2C)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H26N4O2S/c1-20-24(27(34)33(31(20)3)23-17-11-6-12-18-23)19-25-28(35)32(29(36)30(25)2)26(21-13-7-4-8-14-21)22-15-9-5-10-16-22/h4-19,26H,1-3H3 |
| InChIKey | ZTQJOMLUZDSDCM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|