C17H15Cl3N4O4S — CID 92846725
benzyl N-[(1R)-2,2,2-trichloro-1-[(2-nitrophenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 92846725) has the molecular formula C17H15Cl3N4O4S and a molecular weight of 477.76 g/mol. Its IUPAC name is benzyl N-[(1R)-2,2,2-trichloro-1-[(2-nitrophenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | benzyl N-[(1R)-2,2,2-trichloro-1-[(2-nitrophenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 92846725 |
| Molecular Formula | C17H15Cl3N4O4S |
| Molecular Weight | 477.76 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | benzyl N-[(1R)-2,2,2-trichloro-1-[(2-nitrophenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | O=C(N[C@H](NC(=S)Nc1ccccc1[N+](=O)[O-])C(Cl)(Cl)Cl)OCc1ccccc1 |
| InChI | InChI=1S/C17H15Cl3N4O4S/c18-17(19,20)14(23-16(25)28-10-11-6-2-1-3-7-11)22-15(29)21-12-8-4-5-9-13(12)24(26)27/h1-9,14H,10H2,(H,23,25)(H2,21,22,29)/t14-/m0/s1 |
| InChIKey | VSFQHELSQIDGPY-AWEZNQCLSA-N |
| XLogP | 4.50 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|