C20H21NO5S2 — CID 9289141
methyl (2R)-4-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]thiomorpholine-2-carboxylate (PubChem CID 9289141) has the molecular formula C20H21NO5S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl (2R)-4-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2R)-4-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9289141 |
| Molecular Formula | C20H21NO5S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | methyl (2R)-4-[2-(2-naphthalen-2-ylsulfanylacetyl)oxyacetyl]thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=O)COC(=O)CSc2ccc3ccccc3c2)CCS1 |
| InChI | InChI=1S/C20H21NO5S2/c1-25-20(24)17-11-21(8-9-27-17)18(22)12-26-19(23)13-28-16-7-6-14-4-2-3-5-15(14)10-16/h2-7,10,17H,8-9,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | DMKBPRPWSXQAKG-QGZVFWFLSA-N |
| XLogP | 2.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |