C22H18N6O6 — CID 92905225
(3R,5R)-2-(4-methylphenyl)-6-nitro-3,5-bis(3-nitrophenyl)-4,5-dihydro-3H-1,2,4-triazine (PubChem CID 92905225) has the molecular formula C22H18N6O6 and a molecular weight of 462.42 g/mol. Its IUPAC name is (3R,5R)-2-(4-methylphenyl)-6-nitro-3,5-bis(3-nitrophenyl)-4,5-dihydro-3H-1,2,4-triazine.
| Compound Name | (3R,5R)-2-(4-methylphenyl)-6-nitro-3,5-bis(3-nitrophenyl)-4,5-dihydro-3H-1,2,4-triazine |
|---|---|
| PubChem CID | 92905225 |
| Molecular Formula | C22H18N6O6 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (3R,5R)-2-(4-methylphenyl)-6-nitro-3,5-bis(3-nitrophenyl)-4,5-dihydro-3H-1,2,4-triazine |
| SMILES | Cc1ccc(N2N=C([N+](=O)[O-])[C@@H](c3cccc([N+](=O)[O-])c3)N[C@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H18N6O6/c1-14-8-10-17(11-9-14)25-21(16-5-3-7-19(13-16)27(31)32)23-20(22(24-25)28(33)34)15-4-2-6-18(12-15)26(29)30/h2-13,20-21,23H,1H3/t20-,21-/m1/s1 |
| InChIKey | IUMHCTKTFYOQKJ-NHCUHLMSSA-N |
| XLogP | 4.25 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|