C20H30N3O2+ — CID 9304512
(2R)-1-[2-(N-cyclohexylanilino)-2-oxoethyl]piperidin-1-ium-2-carboxamide (PubChem CID 9304512) has the molecular formula C20H30N3O2+ and a molecular weight of 344.48 g/mol. Its IUPAC name is (2R)-1-[2-(N-cyclohexylanilino)-2-oxoethyl]piperidin-1-ium-2-carboxamide.
| Compound Name | (2R)-1-[2-(N-cyclohexylanilino)-2-oxoethyl]piperidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 9304512 |
| Molecular Formula | C20H30N3O2+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | (2R)-1-[2-(N-cyclohexylanilino)-2-oxoethyl]piperidin-1-ium-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCC[NH+]1CC(=O)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H29N3O2/c21-20(25)18-13-7-8-14-22(18)15-19(24)23(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1,3-4,9-10,17-18H,2,5-8,11-15H2,(H2,21,25)/p+1/t18-/m1/s1 |
| InChIKey | BAIMNCLQWQPTEQ-GOSISDBHSA-O |
| XLogP | 1.27 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |