C11H22N6O2 — CID 93233200
[(E)-[(2S,3S,5S)-2-(2-carbamoylhydrazinyl)-5-ethyl-3-methylcyclohexylidene]amino]urea (PubChem CID 93233200) has the molecular formula C11H22N6O2 and a molecular weight of 270.34 g/mol. Its IUPAC name is [(E)-[(2S,3S,5S)-2-(2-carbamoylhydrazinyl)-5-ethyl-3-methylcyclohexylidene]amino]urea.
| Compound Name | [(E)-[(2S,3S,5S)-2-(2-carbamoylhydrazinyl)-5-ethyl-3-methylcyclohexylidene]amino]urea |
|---|---|
| PubChem CID | 93233200 |
| Molecular Formula | C11H22N6O2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [(E)-[(2S,3S,5S)-2-(2-carbamoylhydrazinyl)-5-ethyl-3-methylcyclohexylidene]amino]urea |
| SMILES | CC[C@@H]1C/C(=N\NC(N)=O)[C@@H](NNC(N)=O)[C@@H](C)C1 |
| InChI | InChI=1S/C11H22N6O2/c1-3-7-4-6(2)9(15-17-11(13)19)8(5-7)14-16-10(12)18/h6-7,9,15H,3-5H2,1-2H3,(H3,12,16,18)(H3,13,17,19)/b14-8+/t6-,7-,9-/m0/s1 |
| InChIKey | JEZGJNFSDKQEDR-LAYCNLHOSA-N |
| XLogP | 0.01 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|