About [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate
[(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 9331816) has the molecular formula C14H16ClNO5S
and a molecular weight of 345.80 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| PubChem CID | 9331816 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)O[C@H]2CCCCC2=O)ccc1Cl |
| InChI | InChI=1S/C14H16ClNO5S/c1-16-22(19,20)13-8-9(6-7-10(13)15)14(18)21-12-5-3-2-4-11(12)17/h6-8,12,16H,2-5H2,1H3/t12-/m0/s1 |
| InChIKey | OWNOKZKUEZIICB-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate?
The IUPAC name of [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate (CID 9331816) is [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate.
What is the SMILES notation for [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate?
The canonical SMILES for [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate is CNS(=O)(=O)c1cc(C(=O)O[C@H]2CCCCC2=O)ccc1Cl.
What is the InChIKey of [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate?
The InChIKey is OWNOKZKUEZIICB-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H16ClNO5S/c1-16-22(19,20)13-8-9(6-7-10(13)15)14(18)21-12-5-3-2-4-11(12)17/h6-8,12,16H,2-5H2,1H3/t12-/m0/s1.
What are the key properties of [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate?
[(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate has a molecular weight of 345.80 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-oxocyclohexyl] 4-chloro-3-(methylsulfamoyl)benzoate is sourced from PubChem (CID 9331816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).