C24H20N4S — CID 9342400
(E)-3-[1-benzyl-3-(3-methylphenyl)pyrazol-4-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 9342400) has the molecular formula C24H20N4S and a molecular weight of 396.52 g/mol. Its IUPAC name is (E)-3-[1-benzyl-3-(3-methylphenyl)pyrazol-4-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[1-benzyl-3-(3-methylphenyl)pyrazol-4-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9342400 |
| Molecular Formula | C24H20N4S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (E)-3-[1-benzyl-3-(3-methylphenyl)pyrazol-4-yl]-2-(4-methyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cccc(-c2nn(Cc3ccccc3)cc2/C=C(\C#N)c2nc(C)cs2)c1 |
| InChI | InChI=1S/C24H20N4S/c1-17-7-6-10-20(11-17)23-22(12-21(13-25)24-26-18(2)16-29-24)15-28(27-23)14-19-8-4-3-5-9-19/h3-12,15-16H,14H2,1-2H3/b21-12+ |
| InChIKey | LHJQUWCVSDCPDZ-CIAFOILYSA-N |
| XLogP | 5.74 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|