C17H23N3OS — CID 9344816
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-di(propan-2-yl)benzamide (PubChem CID 9344816) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-di(propan-2-yl)benzamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 9344816 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-di(propan-2-yl)benzamide |
| SMILES | CCc1nnc(NC(=O)c2ccc(C(C)C)cc2C(C)C)s1 |
| InChI | InChI=1S/C17H23N3OS/c1-6-15-19-20-17(22-15)18-16(21)13-8-7-12(10(2)3)9-14(13)11(4)5/h7-11H,6H2,1-5H3,(H,18,20,21) |
| InChIKey | BIYUJHYULYQLIK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |