C17H16N2O5 — CID 9354663
(Z)-1-(2,3-dimethoxyphenyl)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]methanimine (PubChem CID 9354663) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is (Z)-1-(2,3-dimethoxyphenyl)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]methanimine.
| Compound Name | (Z)-1-(2,3-dimethoxyphenyl)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 9354663 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (Z)-1-(2,3-dimethoxyphenyl)-N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methoxy]methanimine |
| SMILES | COc1cccc(/C=N\OCc2cc(-c3ccco3)on2)c1OC |
| InChI | InChI=1S/C17H16N2O5/c1-20-15-6-3-5-12(17(15)21-2)10-18-23-11-13-9-16(24-19-13)14-7-4-8-22-14/h3-10H,11H2,1-2H3/b18-10- |
| InChIKey | KFXNYQYYXGJPCY-ZDLGFXPLSA-N |
| XLogP | 3.50 |
| TPSA | 79.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|