C15H9F2NO2 — CID 9366758
(E)-3-(2,4-difluorophenyl)-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile (PubChem CID 9366758) has the molecular formula C15H9F2NO2 and a molecular weight of 273.24 g/mol. Its IUPAC name is (E)-3-(2,4-difluorophenyl)-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,4-difluorophenyl)-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9366758 |
| Molecular Formula | C15H9F2NO2 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (E)-3-(2,4-difluorophenyl)-2-(2-methylfuran-3-carbonyl)prop-2-enenitrile |
| SMILES | Cc1occc1C(=O)/C(C#N)=C/c1ccc(F)cc1F |
| InChI | InChI=1S/C15H9F2NO2/c1-9-13(4-5-20-9)15(19)11(8-18)6-10-2-3-12(16)7-14(10)17/h2-7H,1H3/b11-6+ |
| InChIKey | GXUYABBUGRQICO-IZZDOVSWSA-N |
| XLogP | 3.66 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|