C16H22N2O6S — CID 9459175
[2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 9459175) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is [2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 9459175 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CCCNC(=O)CN(C)C(=O)COC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H22N2O6S/c1-4-9-17-14(19)10-18(2)15(20)11-24-16(21)12-7-5-6-8-13(12)25(3,22)23/h5-8H,4,9-11H2,1-3H3,(H,17,19) |
| InChIKey | WHVWNDZISFPTIG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |