C14H14BrF2NO4 — CID 94815429
[5-bromo-2-(difluoromethoxy)phenyl]methyl (3R)-1-methyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 94815429) has the molecular formula C14H14BrF2NO4 and a molecular weight of 378.17 g/mol. Its IUPAC name is [5-bromo-2-(difluoromethoxy)phenyl]methyl (3R)-1-methyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [5-bromo-2-(difluoromethoxy)phenyl]methyl (3R)-1-methyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 94815429 |
| Molecular Formula | C14H14BrF2NO4 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | [5-bromo-2-(difluoromethoxy)phenyl]methyl (3R)-1-methyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CN1C[C@H](C(=O)OCc2cc(Br)ccc2OC(F)F)CC1=O |
| InChI | InChI=1S/C14H14BrF2NO4/c1-18-6-8(5-12(18)19)13(20)21-7-9-4-10(15)2-3-11(9)22-14(16)17/h2-4,8,14H,5-7H2,1H3/t8-/m1/s1 |
| InChIKey | GAKXEGCHYJJABU-MRVPVSSYSA-N |
| XLogP | 2.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |