C21H22N2O — CID 95127720
4-[(3R)-1-(furan-2-ylmethyl)pyrrolidin-3-yl]-2-(2-methylphenyl)pyridine (PubChem CID 95127720) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[(3R)-1-(furan-2-ylmethyl)pyrrolidin-3-yl]-2-(2-methylphenyl)pyridine.
| Compound Name | 4-[(3R)-1-(furan-2-ylmethyl)pyrrolidin-3-yl]-2-(2-methylphenyl)pyridine |
|---|---|
| PubChem CID | 95127720 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-[(3R)-1-(furan-2-ylmethyl)pyrrolidin-3-yl]-2-(2-methylphenyl)pyridine |
| SMILES | Cc1ccccc1-c1cc([C@H]2CCN(Cc3ccco3)C2)ccn1 |
| InChI | InChI=1S/C21H22N2O/c1-16-5-2-3-7-20(16)21-13-17(8-10-22-21)18-9-11-23(14-18)15-19-6-4-12-24-19/h2-8,10,12-13,18H,9,11,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | GQZPGQTVQCMICQ-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |