C20H26N4O6S — CID 95278861
(4R)-N-(3-methylbutyl)-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 95278861) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is (4R)-N-(3-methylbutyl)-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-(3-methylbutyl)-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95278861 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (4R)-N-(3-methylbutyl)-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@@H]1CSCN1C(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H26N4O6S/c1-13(2)7-8-21-19(26)16-11-31-12-23(16)18(25)4-3-9-22-15-6-5-14(24(28)29)10-17(15)30-20(22)27/h5-6,10,13,16H,3-4,7-9,11-12H2,1-2H3,(H,21,26)/t16-/m0/s1 |
| InChIKey | SCZKMVHYUFREAZ-INIZCTEOSA-N |
| XLogP | 2.35 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|