C16H15F2N3O4S — CID 95354576
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N'-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxamide (PubChem CID 95354576) has the molecular formula C16H15F2N3O4S and a molecular weight of 383.38 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N'-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N'-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 95354576 |
| Molecular Formula | C16H15F2N3O4S |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N'-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]oxamide |
| SMILES | Cc1nc(C)c([C@@H](C)NC(=O)C(=O)Nc2ccc3c(c2)OC(F)(F)O3)s1 |
| InChI | InChI=1S/C16H15F2N3O4S/c1-7-13(26-9(3)19-7)8(2)20-14(22)15(23)21-10-4-5-11-12(6-10)25-16(17,18)24-11/h4-6,8H,1-3H3,(H,20,22)(H,21,23)/t8-/m1/s1 |
| InChIKey | KZADVTXIPCOGFW-MRVPVSSYSA-N |
| XLogP | 2.90 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|