C38H54O5 — CID 95397172
7-hydroxy-3-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]chromen-4-one (PubChem CID 95397172) has the molecular formula C38H54O5 and a molecular weight of 590.85 g/mol. Its IUPAC name is 7-hydroxy-3-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]chromen-4-one.
| Compound Name | 7-hydroxy-3-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]chromen-4-one |
|---|---|
| PubChem CID | 95397172 |
| Molecular Formula | C38H54O5 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | 7-hydroxy-3-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]chromen-4-one |
| SMILES | Cc1c(C)c2c(c(C)c1Oc1coc3cc(O)ccc3c1=O)CC[C@@](C)(CCC[C@H](C)CCC[C@@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C38H54O5/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-38(8)21-19-31-29(7)36(27(5)28(6)37(31)43-38)42-34-23-41-33-22-30(39)17-18-32(33)35(34)40/h17-18,22-26,39H,9-16,19-21H2,1-8H3/t25-,26+,38+/m0/s1 |
| InChIKey | BNDJSXGDRHCEBG-ZYURWWFDSA-N |
| XLogP | 10.74 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |