C22H36N4O — CID 95551816
pyrrolidin-1-yl-[(3R)-1-[1-(3-pyrrol-1-ylpropyl)piperidin-4-yl]piperidin-3-yl]methanone (PubChem CID 95551816) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is pyrrolidin-1-yl-[(3R)-1-[1-(3-pyrrol-1-ylpropyl)piperidin-4-yl]piperidin-3-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[(3R)-1-[1-(3-pyrrol-1-ylpropyl)piperidin-4-yl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 95551816 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | pyrrolidin-1-yl-[(3R)-1-[1-(3-pyrrol-1-ylpropyl)piperidin-4-yl]piperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(C2CCN(CCCn3cccc3)CC2)C1)N1CCCC1 |
| InChI | InChI=1S/C22H36N4O/c27-22(25-14-3-4-15-25)20-7-5-16-26(19-20)21-8-17-24(18-9-21)13-6-12-23-10-1-2-11-23/h1-2,10-11,20-21H,3-9,12-19H2/t20-/m1/s1 |
| InChIKey | GJPYWGQDQDXZMV-HXUWFJFHSA-N |
| XLogP | 2.68 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |