C9H18NO4S2+ — CID 95565798
[(2S,3S)-2-(1,1-dioxothietan-3-yl)-1,1-dioxothietan-3-yl]-trimethylazanium (PubChem CID 95565798) has the molecular formula C9H18NO4S2+ and a molecular weight of 268.38 g/mol. Its IUPAC name is [(2S,3S)-2-(1,1-dioxothietan-3-yl)-1,1-dioxothietan-3-yl]-trimethylazanium.
| Compound Name | [(2S,3S)-2-(1,1-dioxothietan-3-yl)-1,1-dioxothietan-3-yl]-trimethylazanium |
|---|---|
| PubChem CID | 95565798 |
| Molecular Formula | C9H18NO4S2+ |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [(2S,3S)-2-(1,1-dioxothietan-3-yl)-1,1-dioxothietan-3-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)[C@H]1CS(=O)(=O)[C@H]1C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18NO4S2/c1-10(2,3)8-6-16(13,14)9(8)7-4-15(11,12)5-7/h7-9H,4-6H2,1-3H3/q+1/t8-,9-/m0/s1 |
| InChIKey | LIGHKDVGBNXLBJ-IUCAKERBSA-N |
| XLogP | -1.10 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|