C15H22F3N3O3 — CID 95612311
1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]urea (PubChem CID 95612311) has the molecular formula C15H22F3N3O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 95612311 |
| Molecular Formula | C15H22F3N3O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]urea |
| SMILES | O=C(NCCCN1C(=O)CCC1=O)N[C@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C15H22F3N3O3/c16-15(17,18)10-3-1-4-11(9-10)20-14(24)19-7-2-8-21-12(22)5-6-13(21)23/h10-11H,1-9H2,(H2,19,20,24)/t10-,11+/m1/s1 |
| InChIKey | APDKGOSOACSPFY-MNOVXSKESA-N |
| XLogP | 1.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|