C18H25N5O2 — CID 96563066
(2S)-2-(furan-2-yl)-N-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]azepane-1-carboxamide (PubChem CID 96563066) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-N-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]azepane-1-carboxamide.
| Compound Name | (2S)-2-(furan-2-yl)-N-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 96563066 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (2S)-2-(furan-2-yl)-N-[(8R)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-yl]azepane-1-carboxamide |
| SMILES | Cc1nnc2n1CCC[C@H]2NC(=O)N1CCCCC[C@H]1c1ccco1 |
| InChI | InChI=1S/C18H25N5O2/c1-13-20-21-17-14(7-5-11-22(13)17)19-18(24)23-10-4-2-3-8-15(23)16-9-6-12-25-16/h6,9,12,14-15H,2-5,7-8,10-11H2,1H3,(H,19,24)/t14-,15+/m1/s1 |
| InChIKey | WBFAGSPFXUMOJU-CABCVRRESA-N |
| XLogP | 3.34 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |