C12H16N2O3 — CID 96594837
2-(6,7-dimethoxy-1,3-benzoxazol-2-yl)propan-2-amine (PubChem CID 96594837) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-1,3-benzoxazol-2-yl)propan-2-amine.
| Compound Name | 2-(6,7-dimethoxy-1,3-benzoxazol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 96594837 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(6,7-dimethoxy-1,3-benzoxazol-2-yl)propan-2-amine |
| SMILES | COc1ccc2nc(C(C)(C)N)oc2c1OC |
| InChI | InChI=1S/C12H16N2O3/c1-12(2,13)11-14-7-5-6-8(15-3)10(16-4)9(7)17-11/h5-6H,13H2,1-4H3 |
| InChIKey | ONQOZNSRMCFBLH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |