C17H27N3OS — CID 97090592
1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea (PubChem CID 97090592) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea.
| Compound Name | 1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97090592 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
| SMILES | CN(C)Cc1ccc(CNC(=O)NC[C@@]2(C)CCCS2)cc1 |
| InChI | InChI=1S/C17H27N3OS/c1-17(9-4-10-22-17)13-19-16(21)18-11-14-5-7-15(8-6-14)12-20(2)3/h5-8H,4,9-13H2,1-3H3,(H2,18,19,21)/t17-/m1/s1 |
| InChIKey | LNJROBAWASHFGK-QGZVFWFLSA-N |
| XLogP | 2.83 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |