C9H7F3O3S — CID 97110826
(2S,3S)-2-(benzenesulfonyl)-3-(trifluoromethyl)oxirane (PubChem CID 97110826) has the molecular formula C9H7F3O3S and a molecular weight of 252.21 g/mol. Its IUPAC name is (2S,3S)-2-(benzenesulfonyl)-3-(trifluoromethyl)oxirane.
| Compound Name | (2S,3S)-2-(benzenesulfonyl)-3-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 97110826 |
| Molecular Formula | C9H7F3O3S |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (2S,3S)-2-(benzenesulfonyl)-3-(trifluoromethyl)oxirane |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1O[C@H]1C(F)(F)F |
| InChI | InChI=1S/C9H7F3O3S/c10-9(11,12)7-8(15-7)16(13,14)6-4-2-1-3-5-6/h1-5,7-8H/t7-,8+/m1/s1 |
| InChIKey | BIOBLDGYUIVNOH-SFYZADRCSA-N |
| XLogP | 1.75 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|