C15H22N2OS — CID 97236506
1-[(2S)-4-phenylsulfanylbutan-2-yl]-1,4-diazepan-5-one (PubChem CID 97236506) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-[(2S)-4-phenylsulfanylbutan-2-yl]-1,4-diazepan-5-one.
| Compound Name | 1-[(2S)-4-phenylsulfanylbutan-2-yl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 97236506 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-[(2S)-4-phenylsulfanylbutan-2-yl]-1,4-diazepan-5-one |
| SMILES | C[C@@H](CCSc1ccccc1)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C15H22N2OS/c1-13(17-10-7-15(18)16-9-11-17)8-12-19-14-5-3-2-4-6-14/h2-6,13H,7-12H2,1H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | GIOPGYMRSCOAPS-ZDUSSCGKSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |