About 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide
3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide (PubChem CID 97247400) has the molecular formula C17H19BrN2O2
and a molecular weight of 363.26 g/mol. Its IUPAC name is 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide |
| PubChem CID | 97247400 |
| Molecular Formula | C17H19BrN2O2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)N[C@@H]2CCO[C@H]2C2CC2)c(Br)c2ccccc21 |
| InChI | InChI=1S/C17H19BrN2O2/c1-20-13-5-3-2-4-11(13)14(18)15(20)17(21)19-12-8-9-22-16(12)10-6-7-10/h2-5,10,12,16H,6-9H2,1H3,(H,19,21)/t12-,16+/m1/s1 |
| InChIKey | GJEKTIYRGIWKKG-WBMJQRKESA-N |
| XLogP | 3.24 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide?
The IUPAC name of 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide (CID 97247400) is 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide.
What is the SMILES notation for 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide?
The canonical SMILES for 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide is Cn1c(C(=O)N[C@@H]2CCO[C@H]2C2CC2)c(Br)c2ccccc21.
What is the InChIKey of 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide?
The InChIKey is GJEKTIYRGIWKKG-WBMJQRKESA-N. The full InChI is InChI=1S/C17H19BrN2O2/c1-20-13-5-3-2-4-11(13)14(18)15(20)17(21)19-12-8-9-22-16(12)10-6-7-10/h2-5,10,12,16H,6-9H2,1H3,(H,19,21)/t12-,16+/m1/s1.
What are the key properties of 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide?
3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide has a molecular weight of 363.26 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-[(2S,3R)-2-cyclopropyloxolan-3-yl]-1-methylindole-2-carboxamide is sourced from PubChem (CID 97247400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).