C12H11Cl2N3O2 — CID 97258252
1-(2,5-dichlorophenyl)-3-[(1R)-1-(1,2-oxazol-3-yl)ethyl]urea (PubChem CID 97258252) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[(1R)-1-(1,2-oxazol-3-yl)ethyl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[(1R)-1-(1,2-oxazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 97258252 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[(1R)-1-(1,2-oxazol-3-yl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1cc(Cl)ccc1Cl)c1ccon1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-7(10-4-5-19-17-10)15-12(18)16-11-6-8(13)2-3-9(11)14/h2-7H,1H3,(H2,15,16,18)/t7-/m1/s1 |
| InChIKey | XVKFKHNXDRCHKL-SSDOTTSWSA-N |
| XLogP | 3.86 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |