C14H16Cl2N4O — CID 100763909
1-(2,5-dichlorophenyl)-3-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]urea (PubChem CID 100763909) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 100763909 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]urea |
| SMILES | CC(C)[C@H](NC(=O)Nc1cc(Cl)ccc1Cl)c1ncc[nH]1 |
| InChI | InChI=1S/C14H16Cl2N4O/c1-8(2)12(13-17-5-6-18-13)20-14(21)19-11-7-9(15)3-4-10(11)16/h3-8,12H,1-2H3,(H,17,18)(H2,19,20,21)/t12-/m0/s1 |
| InChIKey | IVZGRIQJMIMVFX-LBPRGKRZSA-N |
| XLogP | 4.24 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |