C23H23N5O2 — CID 97278467
N-[2-[(1R)-1-(1-methylbenzimidazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]acetamide (PubChem CID 97278467) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[2-[(1R)-1-(1-methylbenzimidazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[(1R)-1-(1-methylbenzimidazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 97278467 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[2-[(1R)-1-(1-methylbenzimidazol-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1CCc2c([nH]c3ccccc23)[C@@H]1c1nc2ccccc2n1C |
| InChI | InChI=1S/C23H23N5O2/c1-14(29)24-13-20(30)28-12-11-16-15-7-3-4-8-17(15)25-21(16)22(28)23-26-18-9-5-6-10-19(18)27(23)2/h3-10,22,25H,11-13H2,1-2H3,(H,24,29)/t22-/m1/s1 |
| InChIKey | KIQOSUIBYJHCFC-JOCHJYFZSA-N |
| XLogP | 2.66 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|