C14H19N3O4S2 — CID 97335513
N-[(1S)-1-cyano-2-methoxyethyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 97335513) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[(1S)-1-cyano-2-methoxyethyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[(1S)-1-cyano-2-methoxyethyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 97335513 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[(1S)-1-cyano-2-methoxyethyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | COC[C@H](C#N)NC(=O)c1sccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-21-10-11(9-15)16-14(18)13-12(5-8-22-13)23(19,20)17-6-3-2-4-7-17/h5,8,11H,2-4,6-7,10H2,1H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | MPPHIDBPMSKDJI-NSHDSACASA-N |
| XLogP | 1.19 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |