C10H21NO3 — CID 97358385
2-[[(2R,6R)-2,6-dimethyloxan-4-yl]amino]propane-1,3-diol (PubChem CID 97358385) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-[[(2R,6R)-2,6-dimethyloxan-4-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[(2R,6R)-2,6-dimethyloxan-4-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 97358385 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-[[(2R,6R)-2,6-dimethyloxan-4-yl]amino]propane-1,3-diol |
| SMILES | C[C@@H]1CC(NC(CO)CO)C[C@@H](C)O1 |
| InChI | InChI=1S/C10H21NO3/c1-7-3-9(4-8(2)14-7)11-10(5-12)6-13/h7-13H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | WUOMZXXPEHJFGU-HTQZYQBOSA-N |
| XLogP | -0.11 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |