C16H17N3O3S — CID 97386623
[(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97386623) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is [(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97386623 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [(3R,3aR,6aS)-3-(pyridin-3-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1C[C@H](OCc2cccnc2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C16H17N3O3S/c20-16(13-9-23-10-18-13)19-5-15(12-7-21-8-14(12)19)22-6-11-2-1-3-17-4-11/h1-4,9-10,12,14-15H,5-8H2/t12-,14+,15-/m0/s1 |
| InChIKey | ZTNUTIMTUFRCFL-CFVMTHIKSA-N |
| XLogP | 1.59 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |