C20H30N2O3 — CID 97388807
(4S,4aR,9aR)-4-(cyclopropylmethoxymethyl)-7-(furan-2-ylmethyl)-2-methyl-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one (PubChem CID 97388807) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (4S,4aR,9aR)-4-(cyclopropylmethoxymethyl)-7-(furan-2-ylmethyl)-2-methyl-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one.
| Compound Name | (4S,4aR,9aR)-4-(cyclopropylmethoxymethyl)-7-(furan-2-ylmethyl)-2-methyl-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one |
|---|---|
| PubChem CID | 97388807 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (4S,4aR,9aR)-4-(cyclopropylmethoxymethyl)-7-(furan-2-ylmethyl)-2-methyl-3,4,4a,5,6,8,9,9a-octahydropyrido[3,4-d]azepin-1-one |
| SMILES | CN1C[C@@H](COCC2CC2)[C@H]2CCN(Cc3ccco3)CC[C@H]2C1=O |
| InChI | InChI=1S/C20H30N2O3/c1-21-11-16(14-24-13-15-4-5-15)18-6-8-22(9-7-19(18)20(21)23)12-17-3-2-10-25-17/h2-3,10,15-16,18-19H,4-9,11-14H2,1H3/t16-,18+,19+/m0/s1 |
| InChIKey | ALPOPJAZYHNAEU-QXAKKESOSA-N |
| XLogP | 2.62 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |