C18H22ClN3O — CID 97406804
(3aR,4R,6aS)-2-[(4-chlorophenyl)methyl]-2'-ethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one (PubChem CID 97406804) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-[(4-chlorophenyl)methyl]-2'-ethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one.
| Compound Name | (3aR,4R,6aS)-2-[(4-chlorophenyl)methyl]-2'-ethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 97406804 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (3aR,4R,6aS)-2-[(4-chlorophenyl)methyl]-2'-ethylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
| SMILES | CCC1=N[C@@]2(CC[C@@H]3CN(Cc4ccc(Cl)cc4)C[C@@H]32)C(=O)N1 |
| InChI | InChI=1S/C18H22ClN3O/c1-2-16-20-17(23)18(21-16)8-7-13-10-22(11-15(13)18)9-12-3-5-14(19)6-4-12/h3-6,13,15H,2,7-11H2,1H3,(H,20,21,23)/t13-,15+,18-/m1/s1 |
| InChIKey | GECJTJJHUMTKFV-QIIPPGSGSA-N |
| XLogP | 2.86 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |