C19H25FN4O2 — CID 97435948
1-ethyl-3-[2-[(3-fluorophenyl)methyl]pyrazol-3-yl]-1-[[(2R)-oxan-2-yl]methyl]urea (PubChem CID 97435948) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(3-fluorophenyl)methyl]pyrazol-3-yl]-1-[[(2R)-oxan-2-yl]methyl]urea.
| Compound Name | 1-ethyl-3-[2-[(3-fluorophenyl)methyl]pyrazol-3-yl]-1-[[(2R)-oxan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97435948 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-ethyl-3-[2-[(3-fluorophenyl)methyl]pyrazol-3-yl]-1-[[(2R)-oxan-2-yl]methyl]urea |
| SMILES | CCN(C[C@H]1CCCCO1)C(=O)Nc1ccnn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN4O2/c1-2-23(14-17-8-3-4-11-26-17)19(25)22-18-9-10-21-24(18)13-15-6-5-7-16(20)12-15/h5-7,9-10,12,17H,2-4,8,11,13-14H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | XMWDDENMDZCVLU-QGZVFWFLSA-N |
| XLogP | 3.49 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |