About 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one
7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one (PubChem CID 97472992) has the molecular formula C20H20N2O5S
and a molecular weight of 400.46 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one |
| PubChem CID | 97472992 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one |
| SMILES | O=C1N(c2ccc3c(c2)OCO3)CC12CCN(S(=O)(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C20H20N2O5S/c23-19-20(13-22(19)15-6-7-17-18(12-15)27-14-26-17)8-10-21(11-9-20)28(24,25)16-4-2-1-3-5-16/h1-7,12H,8-11,13-14H2 |
| InChIKey | POQHCZCMBBFVTQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one?
The IUPAC name of 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one (CID 97472992) is 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one.
What is the SMILES notation for 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one?
The canonical SMILES for 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one is O=C1N(c2ccc3c(c2)OCO3)CC12CCN(S(=O)(=O)c1ccccc1)CC2.
What is the InChIKey of 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one?
The InChIKey is POQHCZCMBBFVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O5S/c23-19-20(13-22(19)15-6-7-17-18(12-15)27-14-26-17)8-10-21(11-9-20)28(24,25)16-4-2-1-3-5-16/h1-7,12H,8-11,13-14H2.
What are the key properties of 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one?
7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one has a molecular weight of 400.46 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-2-(1,3-benzodioxol-5-yl)-2,7-diazaspiro[3.5]nonan-3-one is sourced from PubChem (CID 97472992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).