C19H19NO3S — CID 177497849
1'-(benzenesulfonyl)spiro[2H-indene-3,4'-piperidine]-1-one (PubChem CID 177497849) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is 1'-(benzenesulfonyl)spiro[2H-indene-3,4'-piperidine]-1-one.
| Compound Name | 1'-(benzenesulfonyl)spiro[2H-indene-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 177497849 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1'-(benzenesulfonyl)spiro[2H-indene-3,4'-piperidine]-1-one |
| SMILES | O=C1CC2(CCN(S(=O)(=O)c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H19NO3S/c21-18-14-19(17-9-5-4-8-16(17)18)10-12-20(13-11-19)24(22,23)15-6-2-1-3-7-15/h1-9H,10-14H2 |
| InChIKey | IAMLLGYCJHASDT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |