C10H13F7 — CID 98041497
(E)-1,1,1,2,2,3,3-heptafluorodec-4-ene (PubChem CID 98041497) has the molecular formula C10H13F7 and a molecular weight of 266.20 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3-heptafluorodec-4-ene.
| Compound Name | (E)-1,1,1,2,2,3,3-heptafluorodec-4-ene |
|---|---|
| PubChem CID | 98041497 |
| Molecular Formula | C10H13F7 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (E)-1,1,1,2,2,3,3-heptafluorodec-4-ene |
| SMILES | CCCCC/C=C/C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F7/c1-2-3-4-5-6-7-8(11,12)9(13,14)10(15,16)17/h6-7H,2-5H2,1H3/b7-6+ |
| InChIKey | HMGKWDKYLWEYAV-VOTSOKGWSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|