C20H20N2OS — CID 98056824
N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenothiazine-10-carboxamide (PubChem CID 98056824) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenothiazine-10-carboxamide.
| Compound Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 98056824 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]phenothiazine-10-carboxamide |
| SMILES | O=C(N[C@H]1C[C@@H]2CC[C@@H]1C2)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C20H20N2OS/c23-20(21-15-12-13-9-10-14(15)11-13)22-16-5-1-3-7-18(16)24-19-8-4-2-6-17(19)22/h1-8,13-15H,9-12H2,(H,21,23)/t13-,14-,15+/m1/s1 |
| InChIKey | AIBNHSXHEALWEQ-KFWWJZLASA-N |
| XLogP | 5.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |