C20H17N5 — CID 98066364
(2R)-5-amino-2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile (PubChem CID 98066364) has the molecular formula C20H17N5 and a molecular weight of 327.39 g/mol. Its IUPAC name is (2R)-5-amino-2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile.
| Compound Name | (2R)-5-amino-2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile |
|---|---|
| PubChem CID | 98066364 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2R)-5-amino-2-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-2H-pyrrole-3,3,4-tricarbonitrile |
| SMILES | N#CC1=C(N)N(c2ccccc2)[C@H]([C@H]2C[C@H]3C=C[C@H]2C3)C1(C#N)C#N |
| InChI | InChI=1S/C20H17N5/c21-10-17-19(24)25(15-4-2-1-3-5-15)18(20(17,11-22)12-23)16-9-13-6-7-14(16)8-13/h1-7,13-14,16,18H,8-9,24H2/t13-,14-,16-,18+/m0/s1 |
| InChIKey | LAAMVVDACMVNFP-ILXVDBEPSA-N |
| XLogP | 2.81 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|