C25H25Br2NO6 — CID 98130506
[6-[(2R)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 98130506) has the molecular formula C25H25Br2NO6 and a molecular weight of 595.28 g/mol. Its IUPAC name is [6-[(2R)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [6-[(2R)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 98130506 |
| Molecular Formula | C25H25Br2NO6 |
| Molecular Weight | 595.28 g/mol |
| Exact Mass | 593.00 |
| IUPAC Name | [6-[(2R)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | Cc1cc(=O)oc2c(C)c(OC(=O)[C@@H](C)NC(=O)OCc3ccccc3)c(C[C@@H](Br)CBr)cc12 |
| InChI | InChI=1S/C25H25Br2NO6/c1-14-9-21(29)33-23-15(2)22(18(11-20(14)23)10-19(27)12-26)34-24(30)16(3)28-25(31)32-13-17-7-5-4-6-8-17/h4-9,11,16,19H,10,12-13H2,1-3H3,(H,28,31)/t16-,19-/m1/s1 |
| InChIKey | JNBJRIMLKDJQLH-VQIMIIECSA-N |
| XLogP | 5.33 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|