C27H29Br2NO6 — CID 3528208
[6-(2,3-dibromopropyl)-4,8-dimethyl-2-oxochromen-7-yl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 3528208) has the molecular formula C27H29Br2NO6 and a molecular weight of 623.34 g/mol. Its IUPAC name is [6-(2,3-dibromopropyl)-4,8-dimethyl-2-oxochromen-7-yl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [6-(2,3-dibromopropyl)-4,8-dimethyl-2-oxochromen-7-yl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 3528208 |
| Molecular Formula | C27H29Br2NO6 |
| Molecular Weight | 623.34 g/mol |
| Exact Mass | 621.04 |
| IUPAC Name | [6-(2,3-dibromopropyl)-4,8-dimethyl-2-oxochromen-7-yl] 3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | Cc1cc(=O)oc2c(C)c(OC(=O)C(NC(=O)OCc3ccccc3)C(C)C)c(CC(Br)CBr)cc12 |
| InChI | InChI=1S/C27H29Br2NO6/c1-15(2)23(30-27(33)34-14-18-8-6-5-7-9-18)26(32)36-24-17(4)25-21(16(3)10-22(31)35-25)12-19(24)11-20(29)13-28/h5-10,12,15,20,23H,11,13-14H2,1-4H3,(H,30,33) |
| InChIKey | KOKUZDLUKHUQFA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|