C28H31Br2NO6 — CID 99658740
[6-[(2S)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] 6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 99658740) has the molecular formula C28H31Br2NO6 and a molecular weight of 637.37 g/mol. Its IUPAC name is [6-[(2S)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] 6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | [6-[(2S)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] 6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 99658740 |
| Molecular Formula | C28H31Br2NO6 |
| Molecular Weight | 637.37 g/mol |
| Exact Mass | 635.05 |
| IUPAC Name | [6-[(2S)-2,3-dibromopropyl]-4,8-dimethyl-2-oxochromen-7-yl] 6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | Cc1cc(=O)oc2c(C)c(OC(=O)CCCCCNC(=O)OCc3ccccc3)c(C[C@H](Br)CBr)cc12 |
| InChI | InChI=1S/C28H31Br2NO6/c1-18-13-25(33)37-27-19(2)26(21(15-23(18)27)14-22(30)16-29)36-24(32)11-7-4-8-12-31-28(34)35-17-20-9-5-3-6-10-20/h3,5-6,9-10,13,15,22H,4,7-8,11-12,14,16-17H2,1-2H3,(H,31,34)/t22-/m0/s1 |
| InChIKey | CIRJWZUXIQKRAW-QFIPXVFZSA-N |
| XLogP | 6.50 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.37 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|